Find in Library
Search millions of books, articles, and more
Indexed Open Access Databases
Crystal structure of di(2,2'-bipyridine)di[µ-(2-furancarboxylato-O,O')- µ-(2-furancarboxylato-O,O':O')]di(nitrato)disamarium(III), Sm2(NO3)2(C5H3O3)4(C10H8N2)2
oleh: Li X., Zou Y.-Q.
| Format: | Article |
|---|---|
| Diterbitkan: | De Gruyter 2003-06-01 |
Deskripsi
C20H14N3O9Sm, triclinic, P1 (No. 2), a = 9.981(4) Å, b = 10.266(5) Å, c = 11.082(5) Å, α = 85.556(8)°, β = 75.913(8)°, γ = 70.087(7)°, V = 1035.5 Å3, Z = 2, Rgt(F) = 0.029, wRref(F2) = 0.070, T = 293 K.