Find in Library
Search millions of books, articles, and more
Indexed Open Access Databases
Crystal structure of aqua(1,10-phenanthroline)bis(2-thiophenecarboxylato) copper(II), Cu(H2O)(C12H8N2)(C4H3SCOO)2
oleh: Feng D.-M., He H.-Y., Jin H.-X., Zhu L.-G.
| Format: | Article |
|---|---|
| Diterbitkan: | De Gruyter 2005-09-01 |
Deskripsi
C22H16CuN2O5S2, monoclinic, P121/c1 (no. 14), a = 8.4228(4) Å, b = 19.7169(7) Å, c = 12.4746(5) Å, β = 91.041(2)°, V = 2071.3 Å3, Z = 4, Rgt(F) = 0.067, wRref(F2) = 0.199, T = 295 K.